CymitQuimica logo

CAS 1352625-30-9

:

3-Bromo-6-fluoropyrazolo[1,5-a]pyridine

Description:
3-Bromo-6-fluoropyrazolo[1,5-a]pyridine is a heterocyclic compound characterized by its unique pyrazolo-pyridine structure, which incorporates both bromine and fluorine substituents. This compound features a pyrazole ring fused to a pyridine ring, contributing to its aromatic properties and potential biological activity. The presence of the bromine atom at the 3-position and the fluorine atom at the 6-position can significantly influence its reactivity and interaction with biological targets. Typically, such compounds are of interest in medicinal chemistry due to their potential as pharmacological agents, particularly in the development of drugs targeting various diseases. The molecular structure allows for diverse interactions with enzymes and receptors, making it a candidate for further research in drug discovery. Additionally, the compound's solubility, stability, and reactivity can be influenced by the halogen substituents, which may also affect its synthesis and application in various chemical reactions. Overall, 3-Bromo-6-fluoropyrazolo[1,5-a]pyridine represents a valuable compound in the field of organic and medicinal chemistry.
Formula:C7H4BrFN2
InChI:InChI=1S/C7H4BrFN2/c8-6-3-10-11-4-5(9)1-2-7(6)11/h1-4H
InChI key:InChIKey=UZRGAYLDHCBIHZ-UHFFFAOYSA-N
SMILES:BrC1=C2N(N=C1)C=C(F)C=C2
Synonyms:
  • 3-Bromo-6-fluoropyrazolo[1,5-a]pyridine
  • Pyrazolo[1,5-a]pyridine, 3-bromo-6-fluoro-
Found 4 products.