CymitQuimica logo

CAS 1353101-49-1

:

methyl 1H-pyrrolo[3,2-c]pyridine-3-carboxylate

Description:
Methyl 1H-pyrrolo[3,2-c]pyridine-3-carboxylate is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures. This compound features a carboxylate functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the methyl ester group enhances its solubility in organic solvents, making it suitable for various chemical reactions. Its unique bicyclic structure may impart interesting biological activities, making it a candidate for pharmaceutical research. The compound is typically synthesized through multi-step organic reactions, which may involve cyclization and esterification processes. Due to its structural complexity, it may exhibit specific interactions with biological targets, warranting further investigation into its pharmacological properties. As with many heterocycles, it may also participate in various chemical transformations, including nucleophilic substitutions and electrophilic additions, which are valuable in synthetic organic chemistry. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c1-13-9(12)7-5-11-8-2-3-10-4-6(7)8/h2-5,11H,1H3
InChI key:LAACYBDGZPXTJM-UHFFFAOYSA-N
SMILES:COC(=O)C1=CNC2=C1C=NC=C2
Found 3 products.