CymitQuimica logo

CAS 135325-18-7

:

Benzeneacetic acid, 4-(trifluoromethyl)-, methyl ester

Description:
Benzeneacetic acid, 4-(trifluoromethyl)-, methyl ester, also known by its CAS number 135325-18-7, is an organic compound characterized by the presence of a benzene ring substituted with a trifluoromethyl group and a methyl ester functional group. This compound typically exhibits a colorless to pale yellow liquid form and is known for its aromatic properties due to the benzene ring. The trifluoromethyl group contributes to its unique chemical reactivity and can enhance lipophilicity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The methyl ester functionality suggests that it can undergo hydrolysis to yield the corresponding acid, which may have different biological activities. Additionally, the presence of fluorine atoms often imparts increased stability and resistance to metabolic degradation. Safety data should be consulted for handling and exposure, as compounds with trifluoromethyl groups can exhibit toxicity and environmental persistence. Overall, this compound is significant in synthetic organic chemistry and material science.
Formula:C10H9F3O2
InChI:InChI=1S/C10H9F3O2/c1-15-9(14)6-7-2-4-8(5-3-7)10(11,12)13/h2-5H,6H2,1H3
InChI key:ONNMKZXKTBYWFA-UHFFFAOYSA-N
SMILES:COC(=O)CC1=CC=C(C=C1)C(F)(F)F
Found 4 products.