CymitQuimica logo

CAS 1353958-38-9

:

(2,3-Dihydro-benzo[1,4]dioxin-6-yl)-piperazin-1-yl-Methanone hydrochloride

Description:
(2,3-Dihydro-benzo[1,4]dioxin-6-yl)-piperazin-1-yl-methanone hydrochloride is a chemical compound characterized by its complex structure, which includes a benzo[dioxin] moiety and a piperazine ring. This compound typically exhibits properties associated with both the dioxin and piperazine functional groups, such as potential biological activity and solubility in various solvents. The presence of the hydrochloride salt form enhances its stability and solubility in aqueous solutions, making it suitable for pharmaceutical applications. The compound may interact with biological targets, potentially influencing neurotransmitter systems or other pathways, which is of interest in medicinal chemistry. Its molecular structure suggests it could be investigated for therapeutic effects, although specific biological activities would need to be determined through empirical studies. As with many synthetic compounds, safety and handling precautions are essential, given the potential for toxicity or adverse effects associated with similar chemical classes.
Formula:C13H17ClN2O3
InChI:InChI=1S/C13H16N2O3.ClH/c16-13(15-5-3-14-4-6-15)10-1-2-11-12(9-10)18-8-7-17-11;/h1-2,9,14H,3-8H2;1H
InChI key:BLXTUOANRKUNNS-UHFFFAOYSA-N
SMILES:C1CN(CCN1)C(=O)C2=CC3=C(C=C2)OCCO3.Cl
Synonyms:
  • (2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)(piperazin-1-yl)Methanone hydrochloride
  • (2,3-Dihydro-benzo[1,4]dioxin-6-yl)-piperazin-1-yl-Methanone hydrochloride
Found 3 products.