CAS 13544-52-0

Formula: C16H13ClO5

InChI: InChI=1S/C16H12O5.ClH/c1-20-11-4-2-9(3-5-11)16-14(19)8-12-13(18)6-10(17)7-15(12)21-16;/h2-8H,1H3,(H2-,17,18,19);1H

InChI key: GRLAQUHRDORRNU-UHFFFAOYSA-N

SMILES: COC1=CC=C(C=C1)C2=[O+]C3=CC(=CC(=C3C=C2O)O)O.[Cl-]

Kaempferidinidin chloride

CAS: 13544-52-0

Kaempferidinidin chloride is a useful organic compound for research related to life sciences and the catalog number is T126005.

Formula: C₁₆H₁₃ClO₅

Color and Shape: Solid

Molecular weight: 320.73

Ref: TM-T126005

Kaempferidinidin chloride

CAS: 13544-52-0

Kaempferidinidin chloride analytical standard provided with w/w absolute assay, to be used for quantitative titration.

Formula: C₁₆H₁₃O₅Cl

Purity: (HPLC) ≥98%

Color and Shape: Powder

Molecular weight: 320.71

Ref: 11-0944S

Methoxypelargonidin

CAS: 13544-52-0

Methoxypelargonidin is an anthocyanidin, which is a type of chemical compound known as a flavonoid. It is derived from natural plant sources, often found in fruits and flowers that exhibit strong pigmentation. Anthocyanidins such as methoxypelargonidin are responsible for the vivid red, purple, and blue colors in many plants.

Formula: C₁₆H₁₃ClO₅

Purity: Min. 95%

Molecular weight: 320.72 g/mol

Ref: 3D-NAA54452