CymitQuimica logo

CAS 1356109-81-3

:

1,1-Dimethylethyl 3-(6-fluoro-2-pyridinyl)-1-azetidinecarboxylate

Description:
1,1-Dimethylethyl 3-(6-fluoro-2-pyridinyl)-1-azetidinecarboxylate, identified by its CAS number 1356109-81-3, is a chemical compound characterized by its unique structural features. It contains an azetidine ring, which is a four-membered saturated heterocyclic structure, and is substituted with a carboxylate group, enhancing its reactivity and potential biological activity. The presence of a 6-fluoro-2-pyridinyl moiety suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. The dimethyl group contributes to the steric bulk around the azetidine ring, potentially influencing its conformational properties and interactions. This compound may be explored for its pharmacological properties, particularly in the development of new therapeutic agents. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, solubility, and reactivity would be assessed to understand its potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C13H17FN2O2
InChI:InChI=1S/C13H17FN2O2/c1-13(2,3)18-12(17)16-7-9(8-16)10-5-4-6-11(14)15-10/h4-6,9H,7-8H2,1-3H3
InChI key:InChIKey=BZMVGOIBDSUZGE-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(C1)C=2N=C(F)C=CC2
Synonyms:
  • 1,1-Dimethylethyl 3-(6-fluoro-2-pyridinyl)-1-azetidinecarboxylate
  • 1-Azetidinecarboxylic acid, 3-(6-fluoro-2-pyridinyl)-, 1,1-dimethylethyl ester
Found 2 products.