CymitQuimica logo

CAS 1356144-48-3

:

4-bromopyrazolo[1,5-a]pyridine-3-carboxylic acid

Description:
4-Bromopyrazolo[1,5-a]pyridine-3-carboxylic acid is a heterocyclic compound characterized by its pyrazolo and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 4-position of the pyrazolo ring enhances its reactivity and can influence its biological activity. The carboxylic acid functional group at the 3-position provides acidic properties, allowing for potential interactions in various chemical environments, including hydrogen bonding and coordination with metal ions. This compound is typically used in medicinal chemistry and research due to its potential as a pharmacophore in drug development. Its structural features may impart specific biological activities, making it a subject of interest in studies related to anti-inflammatory or anti-cancer agents. Additionally, the compound's solubility and stability can vary based on the pH of the environment, which is an important consideration in its application. Overall, 4-bromopyrazolo[1,5-a]pyridine-3-carboxylic acid is a versatile compound with significant implications in chemical and pharmaceutical research.
Formula:C8H5BrN2O2
InChI:InChI=1S/C8H5BrN2O2/c9-6-2-1-3-11-7(6)5(4-10-11)8(12)13/h1-4H,(H,12,13)
InChI key:JFXAXKWHYUASCP-UHFFFAOYSA-N
SMILES:C1=CN2C(=C(C=N2)C(=O)O)C(=C1)Br
Found 4 products.