CAS 1356929-49-1

UWWDHYUMIORJTA-SBCWFVTISA-N

Description:

The chemical substance identified by the name "UWWDHYUMIORJTA-SBCWFVTISA-N" and CAS number "1356929-49-1" is a synthetic compound that belongs to a class of molecules known for their potential applications in various fields, including pharmaceuticals and materials science. While specific characteristics such as molecular weight, boiling point, and solubility may vary, compounds of this nature typically exhibit unique structural features that influence their reactivity and interaction with biological systems. The presence of functional groups within the molecule can dictate its chemical behavior, stability, and potential therapeutic effects. Additionally, the stereochemistry indicated by the name suggests that the compound may have chiral centers, which can significantly affect its biological activity and pharmacokinetics. Overall, the detailed study of this compound would require further investigation through experimental methods such as spectroscopy and chromatography to elucidate its properties and potential applications.

Formula: C₂₇H₂₉D₅N₂O₇

InChI: InChI=1S/C27H34N2O7/c1-5-36-27(33)21(12-11-18-9-7-6-8-10-18)28-17(2)25(30)29-16-20-15-24(35-4)23(34-3)14-19(20)13-22(29)26(31)32/h6-10,14-15,17,21-22,28H,5,11-13,16H2,1-4H3,(H,31,32)/t17-,21-,22-/m0/s1/i6D,7D,8D,9D,10D

InChI key: InChIKey=UWWDHYUMIORJTA-SBCWFVTISA-N

SMILES: C([C@@H](N[C@@H](CCC1=C(C(=C(C(=C1[2H])[2H])[2H])[2H])[2H])C(OCC)=O)C)(=O)N2CC=3C(C[C@H]2C(O)=O)=CC(OC)=C(OC)C3

Synonyms:

• UWWDHYUMIORJTA-SBCWFVTISA-N

Moexipril-d5 HCl

CAS: 1356929-49-1, 82586-52-5

Formula: C₂₇H₂₉D₅N₂O₇·HCl

Color and Shape: White To Off-White Solid

Molecular weight: 503.61 36.46

Ref: 4Z-M-312

Moexipril-d5

CAS: 1356929-49-1

Please enquire for more information about Moexipril-d5 including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₂₇H₃₄N₂O₇

Purity: Min. 95%

Molecular weight: 503.6 g/mol

Ref: 3D-GEC92949