CAS 13590-42-6
:Phenylmethyl (4S)-2,5-dioxo-4-oxazolidineacetate
Description:
Phenylmethyl (4S)-2,5-dioxo-4-oxazolidineacetate, with the CAS number 13590-42-6, is a chemical compound characterized by its oxazolidine structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound typically exhibits properties associated with both esters and cyclic amides, contributing to its potential reactivity and biological activity. The presence of the phenylmethyl group suggests that it may have aromatic characteristics, which can influence its solubility and interaction with other molecules. The dioxo functional groups indicate that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Additionally, the stereochemistry denoted by the (4S) configuration implies specific spatial arrangements that can affect the compound's pharmacological properties and interactions with biological targets. Overall, this compound may be of interest in medicinal chemistry and organic synthesis due to its unique structural features and potential applications.
Formula:C12H11NO5
InChI:InChI=1S/C12H11NO5/c14-10(6-9-11(15)18-12(16)13-9)17-7-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,16)
InChI key:InChIKey=QNIPTEJAZIWFHH-UHFFFAOYSA-N
SMILES:C(C(OCC1=CC=CC=C1)=O)C2C(=O)OC(=O)N2
Synonyms:- 4-Oxazolidineacetic acid, 2,5-dioxo-, benzyl ester, <span class="text-smallcaps">L</span>-
- 4-Oxazolidineacetic acid, 2,5-dioxo-, phenylmethyl ester, (4S)-
- 4-Oxazolidineacetic acid, 2,5-dioxo-, phenylmethyl ester, (S)-
- <span class="text-smallcaps">L</span>-Aspartic acid β-benzyl ester N-carboxylic acid anhydride
- Benzyl (2,5-Dioxo-1,3-Oxazolidin-4-Yl)Acetate
- L-Asp-NCA
- Phenylmethyl (4S)-2,5-dioxo-4-oxazolidineacetate
- benzyl [(4S)-2,5-dioxo-1,3-oxazolidin-4-yl]acetate
- β-Benzyl <span class="text-smallcaps">L</span>-aspartate N-carboxyanhydride
- β-Benzyl <span class="text-smallcaps">L</span>-aspartate-N-carboxylic acid anhydride
- β-Benzyl <span class="text-smallcaps">L</span>-aspartic acid N-carboxyanhydride
- β-Benzyl L-aspartate N-carboxyanhydride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
L-Aspartic acid β-benzyl ester N-carboxylic acid anhydride
CAS:Formula:C12H11NO5Purity:95%Color and Shape:SolidMolecular weight:249.2194Benzyl (S)-2-(2,5-dioxooxazolidin-4-yl)acetate
CAS:Benzyl (S)-2-(2,5-dioxooxazolidin-4-yl)acetateFormula:C12H11NO5Purity:98%Molecular weight:249.222(S)-Benzyl 2-(2,5-dioxooxazolidin-4-yl)acetate
CAS:(S)-Benzyl 2-(2,5-dioxooxazolidin-4-yl)acetateFormula:C12H11NO5Purity:97%Molecular weight:249.22β-Benzyl L-Aspartic Acid N-carboxyanhydride
CAS:Controlled ProductApplications β-Benzyl L-Aspartic Acid N-carboxyanhydride is used in the synthesis of PEG-poly(aspartate) block copolymer micelles in cancer cells.
References Eckman, A., et al.: Pharm. Res, 29, 1755 (2012); Guo, M., et al.: Biomateials, 35, 4656 (2014)Formula:C12H11NO5Color and Shape:NeatMolecular weight:249.22(S)-Benzyl 2-(2,5-dioxooxazolidin-4-yl)acetate
CAS:Formula:C12H11NO5Purity:95%Molecular weight:249.222






