CymitQuimica logo

CAS 13600-47-0

:

5-AMINO-3-PYRIDINECARBONITRILE

Description:
5-Amino-3-pyridinecarbonitrile, with the CAS number 13600-47-0, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a cyano group (-C≡N) attached to the pyridine ring, contributing to its reactivity and potential applications in various chemical syntheses. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The compound is of interest in medicinal chemistry and materials science, as it can serve as a building block for the synthesis of more complex molecules. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested. Overall, 5-amino-3-pyridinecarbonitrile is a versatile compound with significant potential in various chemical applications.
Formula:C6H5N3
InChI:InChI=1/C6H5N3/c7-2-5-1-6(8)4-9-3-5/h1,3-4H,8H2
InChI key:VGGLPUFUWXSMFB-UHFFFAOYSA-N
SMILES:c1c(C#N)cncc1N
Synonyms:
  • 3-Pyridinecarbonitrile, 5-Amino-
  • 5-Aminonicotinonitrile
  • 5-Aminopyridine-3-carbonitrile
Found 4 products.