CAS 13602-53-4: Angiotensin III
Description:Angiotensin III is a peptide hormone that plays a crucial role in the regulation of blood pressure and fluid balance in the body. It is derived from angiotensin II through the action of aminopeptidases and is part of the renin-angiotensin system. Angiotensin III has a structure that consists of eight amino acids, specifically a sequence that includes the first four amino acids of angiotensin II, with the addition of two more. This peptide is known to bind to angiotensin receptors, influencing vasoconstriction and stimulating aldosterone secretion, which in turn affects sodium retention and blood volume. Its biological activity is similar to that of angiotensin II, although it is generally considered to have a slightly lower potency. Angiotensin III is involved in various physiological processes, including cardiovascular regulation and electrolyte balance, making it significant in both health and disease states, particularly in conditions like hypertension and heart failure. Understanding its characteristics and functions is essential for developing therapeutic strategies targeting the renin-angiotensin system.
Formula:C46H66N12O9
InChI:InChI=1/C46H66N12O9/c1-5-27(4)38(57-40(61)33(21-29-15-17-31(59)18-16-29)53-42(63)37(26(2)3)56-39(60)32(47)13-9-19-51-46(48)49)43(64)54-34(23-30-24-50-25-52-30)44(65)58-20-10-14-36(58)41(62)55-35(45(66)67)22-28-11-7-6-8-12-28/h6-8,11-12,15-18,24-27,32-38,59H,5,9-10,13-14,19-23,47H2,1-4H3,(H,50,52)(H,53,63)(H,54,64)(H,55,62)(H,56,60)(H,57,61)(H,66,67)(H4,48,49,51)/t27-,32-,33-,34-,35-,36-,37-,38-/m0/s1
- Synonyms:
- H-Arg-Val-Tyr-Ile-His-Pro-Phe-OH
- N~5~-(diaminomethylidene)-L-ornithyl-L-valyl-L-tyrosyl-L-isoleucyl-L-histidyl-L-prolyl-L-phenylalanine