CAS 136122-15-1
:2,5-Bis(mercaptomethyl)-1,4-dithiane
Description:
2,5-Bis(mercaptomethyl)-1,4-dithiane is a chemical compound characterized by its unique structure, which includes a dithiane ring with two mercaptomethyl groups attached. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its strong sulfur odor, which is characteristic of thiol compounds. The presence of mercaptomethyl groups imparts significant reactivity, particularly in nucleophilic substitution reactions, making it useful in organic synthesis and as a building block in the preparation of more complex molecules. Additionally, the compound exhibits properties typical of thiols, such as the ability to form disulfide bonds and participate in redox reactions. Its solubility in polar solvents and limited solubility in non-polar solvents reflects its polar nature due to the thiol groups. Safety precautions are necessary when handling this compound, as thiols can be toxic and have strong odors that may be irritating. Overall, 2,5-Bis(mercaptomethyl)-1,4-dithiane is a versatile compound with applications in various fields, including pharmaceuticals and materials science.
Formula:C6H12S4
InChI:InChI=1S/C6H12S4/c7-1-5-3-10-6(2-8)4-9-5/h5-8H,1-4H2
InChI key:InChIKey=COYTVZAYDAIHDK-UHFFFAOYSA-N
SMILES:C(S)C1CSC(CS)CS1
Synonyms:- 1,4-Dithiane-2,5-dimethanethiol
- 2,5-Bis(mercaptomethyl)-1,4-dithiane
- [5-(Sulfanylmethyl)-1,4-dithian-2-yl]methanethiol
- 2,5-Dimercaptomethyl-1,4-dithiane
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1,4-Dithiane-2,5-di(methanethiol)
CAS:1,4-Dithiane-2,5-di(methanethiol)Formula:C6H12S4Purity:≥95%Molecular weight:212.419481,4-Dithiane-2,5-di(methanethiol)
CAS:1,4-Dithiane-2,5-di(methanethiol) is a monomer that belongs to the class of diisocyanates. It has been shown that this molecule reacts with a chloride ion to form a sulfide bond. The compound also has an absorption spectrum in the UV region with maxima at 253 and 290 nm. The compound can be used as an optical material or can be polymerized into polyurethanes. 1,4-Dithiane-2,5-di(methanethiol) is sensitive to oxidation by air and light.Formula:C6H12S4Purity:Min. 84 Area-%Color and Shape:Clear LiquidMolecular weight:212.42 g/molRef: 3D-FD41582
Discontinued product



