CymitQuimica logo

CAS 1363382-82-4

:

methyl 2-bromoimidazo[1,2-a]pyridine-8-carboxylate

Description:
Methyl 2-bromoimidazo[1,2-a]pyridine-8-carboxylate is a chemical compound characterized by its unique structure, which includes a bromine atom, an imidazole ring, and a pyridine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and reactivity due to the presence of the bromine substituent, which can participate in nucleophilic substitution reactions. The carboxylate functional group contributes to its solubility in polar solvents and may influence its reactivity in various chemical processes. Additionally, the imidazo and pyridine rings can provide sites for coordination with metal ions, making it of interest in coordination chemistry and medicinal chemistry. The compound may also exhibit fluorescence or other photophysical properties, depending on its environment. Overall, methyl 2-bromoimidazo[1,2-a]pyridine-8-carboxylate is a versatile compound with potential applications in pharmaceuticals and materials science, warranting further investigation into its chemical behavior and biological activity.
Formula:C9H7BrN2O2
InChI:InChI=1S/C9H7BrN2O2/c1-14-9(13)6-3-2-4-12-5-7(10)11-8(6)12/h2-5H,1H3
InChI key:AHRNKKKJBWWDTO-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC=CN2C1=NC(=C2)Br
Found 3 products.