CAS 1365655-91-9
:13,13-Dimethyl-11-oxo-4,7,12-trioxa-10-azatetradecanoic acid
Description:
13,13-Dimethyl-11-oxo-4,7,12-trioxa-10-azatetradecanoic acid is a complex organic compound characterized by its unique structure, which includes multiple functional groups such as ketones, amines, and ethers. This compound features a long carbon chain, making it a fatty acid derivative, and the presence of three oxygen atoms in the form of ether linkages contributes to its potential solubility in polar solvents. The dimethyl substitution at the 13th carbon position indicates steric hindrance, which may influence its reactivity and interaction with biological systems. The azetidine ring introduces nitrogen into the structure, potentially affecting its biological activity and properties. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its specific applications and behavior in various chemical environments would depend on its interactions with other molecules, including potential binding to biological targets. Overall, 13,13-Dimethyl-11-oxo-4,7,12-trioxa-10-azatetradecanoic acid represents a fascinating subject for study in organic and medicinal chemistry.
Formula:C12H23NO6
InChI:InChI=1S/C12H23NO6/c1-12(2,3)19-11(16)13-5-7-18-9-8-17-6-4-10(14)15/h4-9H2,1-3H3,(H,13,16)(H,14,15)
InChI key:InChIKey=OZMXZVCAXAQCHJ-UHFFFAOYSA-N
SMILES:O(C(NCCOCCOCCC(O)=O)=O)C(C)(C)C
Synonyms:- 4,7,12-Trioxa-10-azatetradecanoic acid, 13,13-dimethyl-11-oxo-
- 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid
- 3-[2-[2-(tert-Butoxycarbonylamino)ethoxy]ethoxy]propanoic acid
- 13,13-Dimethyl-11-oxo-4,7,12-trioxa-10-azatetradecanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Boc-NH-PEG2-acid
CAS:Formula:C12H23NO6Purity:>95.0%(HPLC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:277.323-[2-(2-([(tert-Butoxy)carbonyl]amino)ethoxy)ethoxy]propanoic acid
CAS:Formula:C12H23NO6Purity:95%Color and Shape:LiquidMolecular weight:277.3141Ref: IN-DA00122Y
100gTo inquire100mg24.00€250mg25.00€1g46.00€5g106.00€10g159.00€25g260.00€50g609.00€250g1,736.00€500g2,773.00€Boc-NH-PEG2-CH2CH2COOH
CAS:Boc-NH-PEG2-CH2CH2COOH is a PEG-based PROTAC linker that can be used to synthesise PROTAC molecules.Formula:C12H23NO6Purity:99.81%Color and Shape:SolidMolecular weight:277.31t-Boc-N-amido-PEG2-acid
CAS:t-Boc-N-amido-PEG2-acidFormula:C12H23NO6Purity:95%Color and Shape:LiquidMolecular weight:277.31412T-BOC-N-AMIDO-PEG2-ACID
CAS:Formula:C12H23NO6Purity:95%Color and Shape:LiquidMolecular weight:277.3174,7,12-Trioxa-10-azatetradecanoic acid, 13,13-dimethyl-11-oxo-
CAS:4,7,12-Trioxa-10-azatetradecanoic acid, 13,13-dimethyl-11-oxo- is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. 4,7,12-Trioxa-10-azatetradecanoic acid, 13,13-dimethyl-11-oxo- is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.Formula:C11H21NO6Purity:Min. 95%Molecular weight:263.29 g/mol





