CymitQuimica logo

CAS 1365969-22-7

:

methyl 4-bromo-3-fluoro-2-methylbenzoate

Description:
Methyl 4-bromo-3-fluoro-2-methylbenzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety with various substituents. The presence of a bromine atom at the para position and a fluorine atom at the meta position relative to the ester functional group contributes to its unique reactivity and physical properties. The methyl group at the ortho position further influences its steric and electronic characteristics. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents and may exhibit moderate stability under standard conditions. Methyl 4-bromo-3-fluoro-2-methylbenzoate can be utilized in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals, due to its functional groups that allow for further chemical modifications. Safety data should be consulted for handling, as halogenated compounds can pose health and environmental risks.
Formula:C9H8BrFO2
InChI:InChI=1S/C9H8BrFO2/c1-5-6(9(12)13-2)3-4-7(10)8(5)11/h3-4H,1-2H3
InChI key:VNAZRCAGSCSSSD-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1F)Br)C(=O)OC
Found 5 products.