CymitQuimica logo

CAS 136888-79-4

:

Pyridine, 2-fluoro-5-methoxy-

Description:
Pyridine, 2-fluoro-5-methoxy- is an organic compound characterized by a pyridine ring substituted with a fluorine atom at the 2-position and a methoxy group at the 5-position. This compound belongs to the class of heterocyclic aromatic compounds, which are known for their stability and unique reactivity due to the presence of nitrogen in the ring. The fluorine substituent can influence the electronic properties of the molecule, potentially enhancing its reactivity in nucleophilic substitution reactions. The methoxy group, being an electron-donating group, can also affect the compound's overall reactivity and solubility in various solvents. Pyridine derivatives are often utilized in the synthesis of pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The presence of both the fluorine and methoxy groups can impart specific biological activities, making this compound of interest in medicinal chemistry. Additionally, its physical properties, such as boiling point and solubility, are influenced by these substituents, which can be critical for its application in various chemical processes.
Formula:C6H6FNO
InChI:InChI=1S/C6H6FNO/c1-9-5-2-3-6(7)8-4-5/h2-4H,1H3
InChI key:KSZQZUAJEWXGQM-UHFFFAOYSA-N
SMILES:COC1=CN=C(C=C1)F
Synonyms:
  • 2-Fluoro-5-methoxypyridine
Found 4 products.