CymitQuimica logo

CAS 13689-19-5

:

Tricyclohexylphosphine oxide

Description:
Tricyclohexylphosphine oxide (CAS 13689-19-5) is an organophosphorus compound characterized by the presence of a phosphorus atom bonded to three cyclohexyl groups and an oxygen atom, resulting in a phosphine oxide structure. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its stability and relatively low reactivity compared to other phosphine oxides, making it useful in various chemical applications, including as a ligand in coordination chemistry and catalysis. Tricyclohexylphosphine oxide exhibits good solubility in organic solvents, which enhances its utility in organic synthesis. Additionally, it can participate in various chemical reactions, such as oxidation and coordination with metals, contributing to its role in organometallic chemistry. Safety considerations should be taken into account, as with many organophosphorus compounds, due to potential toxicity and environmental impact. Overall, tricyclohexylphosphine oxide is a versatile compound with significant applications in both academic and industrial chemistry.
Formula:C18H33OP
InChI:InChI=1/C18H33OP/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h16-18H,1-15H2
InChI key:InChIKey=LEFPWWWXFFNJAA-UHFFFAOYSA-N
SMILES:P(=O)(C1CCCCC1)(C2CCCCC2)C3CCCCC3
Synonyms:
  • Brn 2808763
  • Nsc 222417
  • Phosphine oxide, tricyclohexyl-
  • Tricyclohexylphosphane Oxide
  • 4-16-00-01009 (Beilstein Handbook Reference)
  • Tricyclohexylphosphine oxide
  • tricyclohexyl-phosphineoxid
  • (Dicyclohexylphosphoroso)cyclohexane
Found 5 products.