CAS 13689-20-8
:Cyclohexyldiphenylphosphine oxide
Description:
Cyclohexyldiphenylphosphine oxide, with the CAS number 13689-20-8, is an organophosphorus compound characterized by the presence of a phosphine oxide functional group. It features a cyclohexyl group and two phenyl groups attached to the phosphorus atom, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow solid at room temperature and is known for its stability and relatively low volatility. Cyclohexyldiphenylphosphine oxide is soluble in organic solvents such as dichloromethane and toluene, but it is less soluble in water. It is often used as a ligand in coordination chemistry and catalysis, particularly in reactions involving transition metals. The presence of the phosphine oxide moiety enhances its reactivity and ability to stabilize metal complexes. Additionally, it may exhibit interesting biological activities, making it a subject of research in various fields, including medicinal chemistry and materials science. Proper handling and safety precautions are recommended due to its potential toxicity and reactivity.
Formula:C18H21OP
InChI:InChI=1S/C18H21OP/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-2,4-7,10-13,18H,3,8-9,14-15H2
InChI key:InChIKey=ICVUZKQDJNUMKC-UHFFFAOYSA-N
SMILES:P(=O)(C1CCCCC1)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- Cyclohexyl(Diphenyl)Phosphane Oxide
- Diphenyl(cyclohexyl)phosphine oxide
- Diphenylcyclohexylphosphine oxide
- Phosphine oxide, cyclohexyldiphenyl-
- [Cyclohexyl(phenyl)phosphoryl]benzene
- Cyclohexyldiphenylphosphine oxide
- Cyclohexyldiphenylphosphine oxide, 98+%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Cyclohexyldiphenylphosphine Oxide
CAS:Formula:C18H21OPPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:284.34Cyclohexyldiphenylphosphine oxide, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C18H21OPPurity:98+%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:284.34Phosphine oxide, cyclohexyldiphenyl-
CAS:Formula:C18H21OPPurity:98%Color and Shape:SolidMolecular weight:284.3325Cyclohexyldiphenylphosphine Oxide
CAS:Cyclohexyldiphenylphosphine OxideFormula:C18H21OPPurity:98%Molecular weight:284.34Cyclohexyldiphenylphosphine oxide
CAS:Formula:C18H21OPPurity:98%Color and Shape:SolidMolecular weight:284.339




