CymitQuimica logo

CAS 137129-98-7

:

3-pyridinecarboxylic acid, 6-chloro-2-methyl-

Description:
3-Pyridinecarboxylic acid, 6-chloro-2-methyl- is an organic compound characterized by a pyridine ring substituted with a carboxylic acid group and additional functional groups. The presence of a chlorine atom at the 6-position and a methyl group at the 2-position of the pyridine ring contributes to its unique chemical properties. This compound typically exhibits acidic behavior due to the carboxylic acid functional group, which can donate protons in solution. The chlorine substituent can influence the compound's reactivity and polarity, potentially affecting its solubility in various solvents. Additionally, the methyl group may impact steric hindrance and electronic distribution within the molecule. Such compounds are often of interest in pharmaceutical and agrochemical research due to their potential biological activity and utility in synthesis. Overall, 3-pyridinecarboxylic acid, 6-chloro-2-methyl- represents a versatile structure that can participate in various chemical reactions, making it valuable in organic synthesis and medicinal chemistry.
Formula:C7H6ClNO2
InChI:InChI=1/C7H6ClNO2/c1-4-5(7(10)11)2-3-6(8)9-4/h2-3H,1H3,(H,10,11)
InChI key:SGHDEIVHYSOLRC-UHFFFAOYSA-N
SMILES:Cc1c(ccc(Cl)n1)C(=O)O
Synonyms:
  • 6-Chloro-2-methylnicotinic acid
Found 4 products.