CymitQuimica logo

CAS 13728-34-2

:

dimethyl 2,3-naphthalenedicarboxylate

Description:
Dimethyl 2,3-naphthalenedicarboxylate, with the CAS number 13728-34-2, is an organic compound belonging to the class of naphthalene derivatives. It features two carboxylate groups esterified with methyl groups, making it a dimethyl ester. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is characterized by its aromatic structure, which contributes to its stability and potential reactivity in various chemical reactions, such as esterification and nucleophilic substitution. Dimethyl 2,3-naphthalenedicarboxylate is often used as an intermediate in organic synthesis, particularly in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Its solubility in organic solvents and moderate volatility make it suitable for various applications in chemical research and industry. Additionally, it may exhibit specific physical properties such as melting and boiling points, which are influenced by its molecular structure and intermolecular interactions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C14H12O4
InChI:InChI=1/C14H12O4/c1-17-13(15)11-7-9-5-3-4-6-10(9)8-12(11)14(16)18-2/h3-8H,1-2H3
InChI key:MPDGBCOIHNLQMR-UHFFFAOYSA-N
SMILES:COC(=O)c1cc2ccccc2cc1C(=O)OC
Synonyms:
  • 2,3-Naphthalenedicarboxylic acid dimethyl ester
  • Dimethyl Naphthalene-2,3-Dicarboxylate
Found 4 products.