CymitQuimica logo

CAS 1373028-78-4

:

1,1-Dimethylethyl 2-(hydroxymethyl)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate

Description:
1,1-Dimethylethyl 2-(hydroxymethyl)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate, identified by its CAS number 1373028-78-4, is a chemical compound characterized by its complex spirocyclic structure, which includes both an oxa and azaspiro framework. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility in various solvents. The presence of a hydroxymethyl group enhances its polarity, which may influence its interactions in biological systems. The dimethyl substituent on the nitrogen atom provides steric hindrance, potentially affecting its biological activity and binding properties. Such compounds are often of interest in medicinal chemistry due to their structural diversity and potential pharmacological applications. Additionally, the unique arrangement of functional groups may lead to interesting properties, such as specific binding affinities or enzyme inhibition capabilities. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, making it a candidate for further research in drug development and related fields.
Formula:C14H25NO4
InChI:InChI=1S/C14H25NO4/c1-13(2,3)19-12(17)15-8-6-14(7-9-15)5-4-11(10-16)18-14/h11,16H,4-10H2,1-3H3
InChI key:InChIKey=CDYKLWYIDSDHBS-UHFFFAOYSA-N
SMILES:C(O)C1OC2(CCN(C(OC(C)(C)C)=O)CC2)CC1
Synonyms:
  • 1-Oxa-8-azaspiro[4.5]decane-8-carboxylic acid, 2-(hydroxymethyl)-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 2-(hydroxymethyl)-1-oxa-8-azaspiro[4.5]decane-8-carboxylate
Found 2 products.