CAS 137348-86-8

di-tert-butyl N,N-diisopropylphosphor-amidite

Description:

Di-tert-butyl N,N-diisopropylphosphor-amidite is a chemical compound characterized by its phosphoramidite structure, which is commonly used in the field of organic synthesis, particularly in the synthesis of oligonucleotides. This compound features a phosphorus atom bonded to two tert-butyl groups and two isopropyl groups, contributing to its steric bulk and stability. The presence of the phosphoramidite functional group allows it to act as a nucleophile in various chemical reactions, making it valuable in the formation of phosphodiester bonds. Its unique structure imparts specific reactivity and selectivity in coupling reactions, which are essential in the synthesis of DNA and RNA sequences. Additionally, di-tert-butyl N,N-diisopropylphosphor-amidite is typically handled under inert atmospheres to prevent hydrolysis and degradation, as it can be sensitive to moisture. Overall, this compound is significant in biochemistry and molecular biology for its role in facilitating the synthesis of nucleic acids.

Formula: C₁₄H₃₂NO₂P

InChI: InChI=1/C14H32NO2P/c1-11(2)15(12(3)4)18(16-13(5,6)7)17-14(8,9)10/h11-12H,1-10H3

SMILES: CC(C)N(C(C)C)P(OC(C)(C)C)OC(C)(C)C

Synonyms:

• Di-tert-butyl N,N-diisopropylphosphoramidite
• Di-t-butyl N,N-diisopropylphosphoramidite
• Di-Tert-Butyl Dipropan-2-Ylphosphoramidoite

Di-tert-butyl N,N-Diisopropylphosphoramidite

CAS: 137348-86-8

Formula: C₁₄H₃₂NO₂P

Purity: >95.0%(GC)

Color and Shape: Colorless to Almost colorless clear liquid

Molecular weight: 277.39

Ref: 3B-D4211

Di-tert-butyl N,N-diisopropylphosphoramidite

CAS: 137348-86-8

Formula: C₁₄H₃₂NO₂P

Purity: 96%

Color and Shape: Liquid

Molecular weight: 277.3831

Ref: IN-DA0034SE

Bis(tert-butyl) N,N-bis(isopropyl)phosphoramidite

CAS: 137348-86-8

Bis(tert-butyl) N,N-bis(isopropyl)phosphoramidite

Formula: C₁₄H₃₂NO₂P

Purity: 95%

Color and Shape: colourless liquid

Molecular weight: 277.38g/mol

Ref: 54-OR52229

Di-tert-butyl diisopropylphosphoramidite

CAS: 137348-86-8

Formula: C₁₄H₃₂NO₂P

Purity: 95%

Color and Shape: Liquid, Clear

Molecular weight: 277.389

Ref: 10-F226515

Di-t-butyl N,N-Diisopropylphosphoramidite

Controlled Product

CAS: 137348-86-8

Stability Moisture Sensitive
Applications A phosphinane derivative with immunomodulating activity.
References Mandala, S., et al.: Science, 296, 346 (2002),

Formula: C₁₄H₃₂NO₂P

Color and Shape: Neat

Molecular weight: 277.38

Ref: TR-D429400

Di-t-butyl N,N-diisopropylphosphoramidite

CAS: 137348-86-8

Di-t-butyl N,N-diisopropylphosphoramidite (DIBP) is a halide that is activated by the presence of water. DIBP is used to link two or more molecules together. It can also be used as a bifunctional linker for oligonucleotide synthesis, with carboxylate and amide groups on opposite ends of the molecule. DIBP has been shown to have potential use in treating autoimmune diseases and traumatic brain injury. This compound could also potentially be used to target cells that express matrix metalloproteinase (MMPs) and calcium ions, which are involved in the regulation of cell proliferation and apoptosis.

Formula: C₁₄H₃₂NO₂P

Purity: Min. 95%

Color and Shape: Clear Colourless To Light (Or Pale) Yellow Liquid

Molecular weight: 277.38 g/mol

Ref: 3D-FD22549