CAS 137348-86-8
:di-tert-butyl N,N-diisopropylphosphor-amidite
Description:
Di-tert-butyl N,N-diisopropylphosphor-amidite is a chemical compound characterized by its phosphoramidite structure, which is commonly used in the field of organic synthesis, particularly in the synthesis of oligonucleotides. This compound features a phosphorus atom bonded to two tert-butyl groups and two isopropyl groups, contributing to its steric bulk and stability. The presence of the phosphoramidite functional group allows it to act as a nucleophile in various chemical reactions, making it valuable in the formation of phosphodiester bonds. Its unique structure imparts specific reactivity and selectivity in coupling reactions, which are essential in the synthesis of DNA and RNA sequences. Additionally, di-tert-butyl N,N-diisopropylphosphor-amidite is typically handled under inert atmospheres to prevent hydrolysis and degradation, as it can be sensitive to moisture. Overall, this compound is significant in biochemistry and molecular biology for its role in facilitating the synthesis of nucleic acids.
Formula:C14H32NO2P
InChI:InChI=1/C14H32NO2P/c1-11(2)15(12(3)4)18(16-13(5,6)7)17-14(8,9)10/h11-12H,1-10H3
SMILES:CC(C)N(C(C)C)P(OC(C)(C)C)OC(C)(C)C
Synonyms:- Di-tert-butyl N,N-diisopropylphosphoramidite
- Di-t-butyl N,N-diisopropylphosphoramidite
- Di-Tert-Butyl Dipropan-2-Ylphosphoramidoite
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Di-tert-butyl N,N-Diisopropylphosphoramidite
CAS:Formula:C14H32NO2PPurity:>95.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:277.39Di-tert-butyl N,N-diisopropylphosphoramidite
CAS:Formula:C14H32NO2PPurity:95%Color and Shape:LiquidMolecular weight:277.3831Di-tert-butyl diisopropylphosphoramidite
CAS:Di-tert-butyl diisopropylphosphoramiditeFormula:C14H32NO2PPurity:95%Molecular weight:277.38Bis(tert-butyl) N,N-bis(isopropyl)phosphoramidite
CAS:Bis(tert-butyl) N,N-bis(isopropyl)phosphoramiditeFormula:C14H32NO2PPurity:95%Color and Shape:Liquid-ClearMolecular weight:277.38314Di-tert-butyl diisopropylphosphoramidite
CAS:Formula:C14H32NO2PPurity:95%Color and Shape:Liquid, ClearMolecular weight:277.389Di-t-butyl N,N-Diisopropylphosphoramidite
CAS:Controlled ProductStability Moisture Sensitive
Applications A phosphinane derivative with immunomodulating activity.
References Mandala, S., et al.: Science, 296, 346 (2002),Formula:C14H32NO2PColor and Shape:NeatMolecular weight:277.38Di-t-butyl N,N-diisopropylphosphoramidite
CAS:Di-t-butyl N,N-diisopropylphosphoramidite (DIBP) is a halide that is activated by the presence of water. DIBP is used to link two or more molecules together. It can also be used as a bifunctional linker for oligonucleotide synthesis, with carboxylate and amide groups on opposite ends of the molecule. DIBP has been shown to have potential use in treating autoimmune diseases and traumatic brain injury. This compound could also potentially be used to target cells that express matrix metalloproteinase (MMPs) and calcium ions, which are involved in the regulation of cell proliferation and apoptosis.Formula:C14H32NO2PPurity:Min. 95%Color and Shape:Clear Colourless To Light (Or Pale) Yellow LiquidMolecular weight:277.38 g/mol






