CymitQuimica logo

CAS 1374651-62-3

:

3-Bromo-5-chloro-α-methyl-2-pyridinemethanol

Description:
3-Bromo-5-chloro-α-methyl-2-pyridinemethanol is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of bromine and chlorine substituents at the 3 and 5 positions, respectively, introduces significant reactivity and influences the compound's physical and chemical properties. The α-methyl group contributes to steric hindrance, potentially affecting its interactions with biological targets. As a pyridinemethanol derivative, it features a hydroxymethyl group, which can participate in hydrogen bonding and may enhance solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific reactivity, stability, and potential applications would depend on the context of its use, including synthesis pathways and interactions with other chemical entities. Overall, the unique combination of halogen substituents and functional groups in this compound suggests a diverse range of potential applications in research and industry.
Formula:C7H7BrClNO
InChI:InChI=1S/C7H7BrClNO/c1-4(11)7-6(8)2-5(9)3-10-7/h2-4,11H,1H3
InChI key:InChIKey=AUVBGIYQOJAROI-UHFFFAOYSA-N
SMILES:C(C)(O)C1=C(Br)C=C(Cl)C=N1
Synonyms:
  • 2-Pyridinemethanol, 3-bromo-5-chloro-α-methyl-
  • 3-Bromo-5-chloro-α-methyl-2-pyridinemethanol
Found 3 products.