CymitQuimica logo

CAS 1374652-53-5

:

3-chloroisoquinolin-6-ol

Description:
3-Chloroisoquinolin-6-ol is a chemical compound characterized by its isoquinoline structure, which features a bicyclic aromatic system. The presence of a chlorine atom at the 3-position and a hydroxyl group (-OH) at the 6-position contributes to its unique reactivity and potential biological activity. This compound typically exhibits properties associated with both aromatic compounds and alcohols, such as solubility in organic solvents and the ability to participate in hydrogen bonding due to the hydroxyl group. The chlorine substituent can influence the compound's electronic properties, potentially enhancing its reactivity in electrophilic substitution reactions. Additionally, 3-chloroisoquinolin-6-ol may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization often involve standard organic chemistry techniques, and it may be utilized in various applications, including drug development and as a building block in organic synthesis. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C9H6ClNO
InChI:InChI=1S/C9H6ClNO/c10-9-4-7-3-8(12)2-1-6(7)5-11-9/h1-5,12H
InChI key:UGPQRQFIFJTENM-UHFFFAOYSA-N
SMILES:C1=CC2=CN=C(C=C2C=C1O)Cl
Synonyms:
  • 3-chloroisoquinolin-6-ol
  • 3-Chloroisoquinolin-6-ol, 3-Chloro-6-hydroxy-2-azanaphthalene
  • 3-Chloro-6-hydroxyisoquinoline
Found 4 products.