CymitQuimica logo

CAS 137505-14-7

:

Benzenesulfonamide, 4-chloro-N-(3-pyridinylmethylene)-

Description:
Benzenesulfonamide, 4-chloro-N-(3-pyridinylmethylene)- is a chemical compound characterized by its sulfonamide functional group, which is attached to a benzene ring and features a chloro substituent at the para position. The compound also contains a pyridine moiety linked through a methylene bridge, contributing to its structural complexity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the sulfonamide and pyridine groups, which are known to interact with biological targets. The compound may also exhibit properties such as antibacterial or antifungal activity, making it of interest in drug discovery. Safety and handling precautions should be observed, as with many sulfonamide derivatives, due to potential toxicity or allergenic responses in sensitive individuals.
Formula:C12H9ClN2O2S
InChI:InChI=1S/C12H9ClN2O2S/c13-11-3-5-12(6-4-11)18(16,17)15-9-10-2-1-7-14-8-10/h1-9H/b15-9+
InChI key:POBQREGGXMKCQY-OQLLNIDSSA-N
SMILES:C1=CC(=CN=C1)/C=N/S(=O)(=O)C2=CC=C(C=C2)Cl
Found 1 products.