CymitQuimica logo

CAS 1375302-99-0

:

3-(Benzyloxy)-pyridine-5-boronic acid pinacol ester

Description:
3-(Benzyloxy)-pyridine-5-boronic acid pinacol ester is a chemical compound characterized by its boronic acid functionality, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis, particularly in cross-coupling reactions. The presence of the benzyloxy group enhances its solubility and reactivity, making it a valuable intermediate in the synthesis of various organic compounds. The pinacol ester moiety contributes to the stability of the boronic acid, allowing for easier handling and storage. This compound typically exhibits moderate polarity due to the combination of aromatic and polar functional groups, influencing its solubility in organic solvents. Additionally, it may participate in various chemical reactions, including Suzuki coupling, which is essential for the formation of carbon-carbon bonds in the synthesis of pharmaceuticals and agrochemicals. Overall, 3-(Benzyloxy)-pyridine-5-boronic acid pinacol ester is a versatile building block in synthetic organic chemistry.
Formula:C18H22BNO3
InChI:InChI=1S/C18H22BNO3/c1-17(2)18(3,4)23-19(22-17)15-10-16(12-20-11-15)21-13-14-8-6-5-7-9-14/h5-12H,13H2,1-4H3
InChI key:InChIKey=NAOLHUUUJHXGFQ-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(OCC3=CC=CC=C3)C=NC2
Synonyms:
  • 3-(Benzyloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
  • 3-(Phenylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
  • Pyridine, 3-(phenylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 3-Benzyloxy-pyridine-5-boronic acid picol ester
  • 5-Benzyloxypyridine-3-boronic acid pinacol ester
  • 3-Benzyloxy-pyridine-5-boronic acid pinacol ester
Found 4 products.