CymitQuimica logo

CAS 137536-94-8

:

(4R,5R)-(-)-2,2-Dimethyl-α,α,α',α'-tetra(1-naphthyl)-1,3-dioxolane-4,5-dimethanol

Description:
(4R,5R)-(-)-2,2-Dimethyl-α,α,α',α'-tetra(1-naphthyl)-1,3-dioxolane-4,5-dimethanol, with CAS number 137536-94-8, is a complex organic compound characterized by its unique structural features, including a dioxolane ring and multiple naphthyl groups. This compound exhibits chirality, with specific stereochemistry at the 4 and 5 positions, which can influence its reactivity and interactions in various chemical environments. The presence of hydroxymethyl groups contributes to its potential solubility in polar solvents and may enhance its reactivity in certain chemical reactions, such as nucleophilic substitutions or hydrogen bonding interactions. Additionally, the bulky naphthyl substituents can impart significant steric hindrance, affecting the compound's overall conformation and stability. This compound may find applications in organic synthesis, particularly in the development of chiral catalysts or as intermediates in the synthesis of more complex molecules. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require empirical measurement or detailed literature references for precise values.
Formula:C47H38O4
InChI:InChI=1S/C47H38O4/c1-45(2)50-43(46(48,39-27-11-19-31-15-3-7-23-35(31)39)40-28-12-20-32-16-4-8-24-36(32)40)44(51-45)47(49,41-29-13-21-33-17-5-9-25-37(33)41)42-30-14-22-34-18-6-10-26-38(34)42/h3-30,43-44,48-49H,1-2H3/t43-,44-/m1/s1
InChI key:WTZVNZRNIOJACO-NDOUMJCMSA-N
SMILES:CC1(O[C@H]([C@@H](O1)C(C2=CC=CC3=CC=CC=C32)(C4=CC=CC5=CC=CC=C54)O)C(C6=CC=CC7=CC=CC=C76)(C8=CC=CC9=CC=CC=C98)O)C
Synonyms:
  • (4R,5R)-(-)-2,2-Dimethyl-Alpha,Alpha,Alpha',Alpha'-Tetra(1-Naphthyl)-1,3-Dioxolane-4,5-Dimethanol
Found 5 products.