CAS 13754-38-6
:1-BENZOYLPIPERAZINE
Description:
1-Benzoylpiperazine (CAS 13754-38-6) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic ring containing two nitrogen atoms. This compound features a benzoyl group attached to one of the nitrogen atoms, contributing to its unique properties. It is typically a white to off-white crystalline solid and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water. 1-Benzoylpiperazine is known for its potential psychoactive effects and has been studied for its interactions with various neurotransmitter systems, particularly in relation to its analogs. Its molecular structure allows for various chemical reactions, making it of interest in medicinal chemistry and drug development. Safety data indicates that it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 1-benzoylpiperazine serves as a significant compound in research, particularly in the fields of pharmacology and organic synthesis.
Formula:C11H15N2O
InChI:InChI=1/C11H14N2O/c14-11(10-4-2-1-3-5-10)13-8-6-12-7-9-13/h1-5,12H,6-9H2/p+1
Synonyms:- Chembrdg-Bb 5108505
- Akos Bb-6352
- Phenyl-Piperazin-1-Yl-Methanone
- N-Benzoylpiperazine
- 1-Benzoyl-Piperazine
- 1-Benzotriazolemonhydate Chem-4170
- 4-(Phenylcarbonyl)Piperazin-1-Ium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-Benzoylpiperazine
CAS:Formula:C11H14N2OPurity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalineMolecular weight:190.251-Benzoylpiperazine, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H14N2OPurity:97%Molecular weight:190.24Phenyl(piperazin-1-yl)methanone
CAS:Phenyl(piperazin-1-yl)methanoneFormula:C11H14N2OPurity:≥95%Color and Shape:Pale yellow SolidMolecular weight:190.24166Methanone, phenyl-1-piperazinyl-
CAS:Formula:C11H14N2OPurity:97%Color and Shape:SolidMolecular weight:190.2417






