CymitQuimica logo

CAS 13755-95-8

:

1,4-Naphthalenedione, 2,3-diamino-

Description:
1,4-Naphthalenedione, 2,3-diamino- is an organic compound characterized by its structure, which includes a naphthalene backbone with two amino groups at the 2 and 3 positions and a diketone functional group. This compound is a derivative of naphthalenedione, which is known for its potential applications in various fields, including organic synthesis and materials science. The presence of amino groups suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a versatile intermediate in organic chemistry. Additionally, compounds with similar structures often exhibit interesting electronic properties, which can be exploited in the development of dyes, pigments, or electronic materials. Its solubility and reactivity can vary depending on the solvent and conditions, and it may also exhibit biological activity, warranting further investigation into its potential pharmacological applications. Safety data should be consulted before handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H8N2O2
InChI:InChI=1S/C10H8N2O2/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13/h1-4H,11-12H2
InChI key:YGFBBXYYCLHOOW-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C(=O)C(=C(C2=O)N)N
Found 5 products.