CymitQuimica logo

CAS 137592-43-9

:

1H-Pyrrole-2,5-dione,3-[1-(3-aminopropyl)-1H-indol-3-yl]-4-(1H-indol-3-yl)-

Description:
1H-Pyrrole-2,5-dione, 3-[1-(3-aminopropyl)-1H-indol-3-yl]-4-(1H-indol-3-yl)-, identified by CAS number 137592-43-9, is a complex organic compound featuring a pyrrole dione structure fused with indole moieties. This compound exhibits characteristics typical of heterocyclic compounds, including potential biological activity due to its indole and pyrrole components, which are known for their roles in various biochemical processes. The presence of an amino group suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may confer properties such as solubility in organic solvents and possible reactivity under certain conditions, which could be relevant for synthetic applications or biological assays. Additionally, the compound's unique arrangement of functional groups may influence its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion (ADME). Overall, this substance represents a class of compounds that may have implications in drug development and therapeutic applications.
Formula:C23H20N4O2
InChI:InChI=1S/C23H20N4O2/c24-10-5-11-27-13-17(15-7-2-4-9-19(15)27)21-20(22(28)26-23(21)29)16-12-25-18-8-3-1-6-14(16)18/h1-4,6-9,12-13,25H,5,10-11,24H2,(H,26,28,29)
InChI key:APYXQTXFRIDSGE-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C(=CN2)C3=C(C(=O)NC3=O)C4=CN(C5=CC=CC=C54)CCCN
Found 4 products.