CymitQuimica logo

CAS 137641-68-0

:

1H-Indole, 1-[(1-methyl-2-piperidinyl)methyl]-

Description:
1H-Indole, 1-[(1-methyl-2-piperidinyl)methyl]- is a chemical compound characterized by its indole core, which is a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. This compound features a piperidine moiety, specifically a 1-methyl-2-piperidinyl group, attached to the indole at the 1-position. The presence of the piperidine ring contributes to its potential biological activity, as piperidine derivatives are often associated with various pharmacological effects. The compound is typically a solid or liquid at room temperature, depending on its specific formulation and purity. It is soluble in organic solvents, which is common for indole derivatives, and may exhibit moderate to low solubility in water. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions, given the known activity of indole derivatives in these areas. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C15H20N2
InChI:InChI=1S/C15H20N2/c1-16-10-5-4-7-14(16)12-17-11-9-13-6-2-3-8-15(13)17/h2-3,6,8-9,11,14H,4-5,7,10,12H2,1H3
InChI key:XVOUFWJFSTTZOA-UHFFFAOYSA-N
SMILES:CN1CCCCC1CN2C=CC3=CC=CC=C32
Found 2 products.