CAS 137687-00-4
:4-Methylumbelliferyl 2-Amino-2-deoxy-a-D-glucopyranoside
Description:
4-Methylumbelliferyl 2-Amino-2-deoxy-α-D-glucopyranoside, commonly referred to as 4-MU-GlcN, is a synthetic substrate used primarily in biochemical assays to detect the activity of enzymes such as glycosidases. This compound features a 4-methylumbelliferone moiety, which is a fluorescent marker, allowing for sensitive detection upon enzymatic hydrolysis. The presence of the 2-amino-2-deoxy-α-D-glucopyranoside structure provides a specific target for glycosidase enzymes, making it useful in various research applications, including studies on carbohydrate metabolism and enzyme kinetics. In aqueous solutions, the compound exhibits fluorescence properties that can be quantified, facilitating the measurement of enzyme activity. Its stability and solubility in water make it suitable for laboratory use. Additionally, the compound is often employed in microbiological studies to assess the presence of specific bacterial enzymes, contributing to the understanding of microbial physiology and biochemistry. Overall, 4-MU-GlcN is a valuable tool in enzymology and molecular biology research.
Formula:C16H19NO7
InChI:InChI=1/C16H19NO7/c1-7-4-12(19)23-10-5-8(2-3-9(7)10)22-16-13(17)15(21)14(20)11(6-18)24-16/h2-5,11,13-16,18,20-21H,6,17H2,1H3/t11?,13-,14+,15?,16-/m0/s1
Synonyms:- 4-Methylumbelliferyl 2-Amino-2-deoxy-α-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Methylumbelliferyl 2-Amino-2-deoxy-a-D-glucopyranoside (>90%)
CAS:Formula:C16H19NO7Color and Shape:SolidMolecular weight:337.32464-Methylumbelliferyl 2-Amino-2-deoxy-alpha-D-glucopyranoside (>90%)
CAS:Formula:C16H19NO7Purity:>90%Color and Shape:NeatMolecular weight:337.324-Methylumbelliferyl a-D-glucosaminide
CAS:4-Methylumbelliferyl alpha-D-glucosaminide is a fluorogenic substrate for alpha-N-acetylglucosaminidase. After enzymatic cleaveage, free 4-methylumbelliferone (also known as hymecromone) is released, exhibiting blue fluorescence upon excitation with UV light. The strongest fluorescence of 4-methylumbelliferone requires deprotonation of the hydroxyl group (thus requires alkaline pH), with a maximal fluorescence intensity obtained with excitation at 350 to 370 nm and emission at 440 to 470 nm. The use of 4-methylumbelliferyl alpha-D-glucosaminideas a substrate for measuring the alpha-N-acetylglucosaminidase activity is used for Sanfilippo syndrome B and Mucopolysaccharidosis IIIB (MPS IIIB) diagnosis.Formula:C16H19NO7Purity:Min. 90 Area-%Color and Shape:White PowderMolecular weight:337.32 g/mol



