CymitQuimica logo

CAS 137687-00-4

:

4-Methylumbelliferyl 2-Amino-2-deoxy-a-D-glucopyranoside

Description:
4-Methylumbelliferyl 2-Amino-2-deoxy-α-D-glucopyranoside, commonly referred to as 4-MU-GlcN, is a synthetic substrate used primarily in biochemical assays to detect the activity of enzymes such as glycosidases. This compound features a 4-methylumbelliferone moiety, which is a fluorescent marker, allowing for sensitive detection upon enzymatic hydrolysis. The presence of the 2-amino-2-deoxy-α-D-glucopyranoside structure provides a specific target for glycosidase enzymes, making it useful in various research applications, including studies on carbohydrate metabolism and enzyme kinetics. In aqueous solutions, the compound exhibits fluorescence properties that can be quantified, facilitating the measurement of enzyme activity. Its stability and solubility in water make it suitable for laboratory use. Additionally, the compound is often employed in microbiological studies to assess the presence of specific bacterial enzymes, contributing to the understanding of microbial physiology and biochemistry. Overall, 4-MU-GlcN is a valuable tool in enzymology and molecular biology research.
Formula:C16H19NO7
InChI:InChI=1/C16H19NO7/c1-7-4-12(19)23-10-5-8(2-3-9(7)10)22-16-13(17)15(21)14(20)11(6-18)24-16/h2-5,11,13-16,18,20-21H,6,17H2,1H3/t11?,13-,14+,15?,16-/m0/s1
InChI key:XPBYRVZLJCNXMD-BTAUDXDXSA-N
SMILES:CC1=CC(=O)OC2=C1C=CC(=C2)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)N
Synonyms:
  • 4-Methylumbelliferyl 2-Amino-2-deoxy-α-D-glucopyranoside
Found 5 products.