CAS 137832-55-4

2-CHLOROPROPANE-1,1,1-D3

Description:

2-Chloropropane-1,1,1-D3, also known as 1,1,1-trideuterated 2-chloropropane, is a chlorinated hydrocarbon characterized by the presence of a chlorine atom attached to the second carbon of a three-carbon propane chain, with deuterium isotopes replacing three hydrogen atoms. This compound is a colorless liquid at room temperature and is typically used in organic synthesis and as a solvent in various chemical reactions. Its molecular formula reflects the presence of deuterium, which alters its physical properties slightly compared to its non-deuterated counterpart. The presence of the chlorine atom makes it a polar molecule, influencing its solubility in different solvents. Additionally, 2-chloropropane-1,1,1-D3 can participate in nucleophilic substitution reactions, making it valuable in synthetic organic chemistry. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as chlorinated hydrocarbons can be hazardous to health and the environment.

Formula: C₃H₄ClD₃

InChI: InChI=1S/C3H7Cl/c1-3(2)4/h3H,1-2H3/i1D3

InChI key: ULYZAYCEDJDHCC-FIBGUPNXSA-N

SMILES: [2H]C([2H])([2H])C(C)Cl

2-Chloropropane-1,1,1-d3

CAS: 137832-55-4, 75-29-6

Formula: CH₃CH(Cl)CD₃

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 81.04246

Ref: 3U-D5634

2-Chloropropane-1,1,1-d3

Controlled Product

CAS: 137832-55-4

Formula: C₃D₃H₄Cl

Color and Shape: Neat

Molecular weight: 81.5592

Ref: TR-C379211