CAS 137975-06-5
:Mozavaptan
Description:
Mozavaptan is a chemical compound classified as a vasopressin receptor antagonist, specifically targeting the V2 receptor subtype. It is primarily investigated for its potential therapeutic applications in treating conditions such as hyponatremia and heart failure. The compound exhibits a unique structure that allows it to effectively inhibit the action of vasopressin, a hormone that regulates water retention in the kidneys. Mozavaptan's mechanism of action involves blocking the reabsorption of water, leading to increased urine output and a subsequent rise in serum sodium levels. In terms of physical properties, it is typically presented as a white to off-white solid, and its solubility profile suggests it is soluble in organic solvents but may have limited solubility in water. Safety and efficacy studies are crucial for understanding its pharmacokinetics and potential side effects. Overall, Mozavaptan represents a significant advancement in the management of fluid balance disorders, although further research is necessary to fully elucidate its clinical benefits and risks.
Formula:C27H29N3O2
InChI:InChI=1S/C27H29N3O2/c1-19-9-4-5-10-22(19)26(31)28-21-16-14-20(15-17-21)27(32)30-18-8-13-24(29(2)3)23-11-6-7-12-25(23)30/h4-7,9-12,14-17,24H,8,13,18H2,1-3H3,(H,28,31)
InChI key:InChIKey=WRNXUQJJCIZICJ-UHFFFAOYSA-N
SMILES:C(=O)(N1C=2C(C(N(C)C)CCC1)=CC=CC2)C3=CC=C(NC(=O)C4=C(C)C=CC=C4)C=C3
Synonyms:- 1H-1-Benzazepine, benzamide deriv.
- 5-(Dimethylamino)-1-[4-(2-methylbenzamido)benzoyl]-2,3,4,5-tetrahydro-1H-benzazepine
- Benzamide, N-[4-[[5-(dimethylamino)-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl]carbonyl]phenyl]-2-methyl-
- N-(4-{[5-(dimethylamino)-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl]carbonyl}phenyl)-2-methylbenzamide
- Opc 31260
- Mozavaptan
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Mozavaptan-d6
CAS:Formula:C27H23D6N3O2Color and Shape:White To Off-White SolidMolecular weight:433.58Mozavaptan
CAS:Mozavaptan (OPC-31260) is a competitive vasopressin receptor antagonist for both V1 and V2 receptors with IC50 of 1.2 μM and 14 nM, respectively.Formula:C27H29N3O2Purity:98.98% - 99.12%Color and Shape:SolidMolecular weight:427.54Mozavaptan
CAS:Controlled Product<p>Mozavaptan is a pharmacological agent that acts as a vasopressin V2 receptor antagonist. It is derived through synthetic chemical processes designed to target specific neurohormonal pathways in the body. Mozavaptan exerts its effects by inhibiting the action of vasopressin, a hormone that promotes water reabsorption in the kidneys. By blocking the vasopressin receptors, it enhances water excretion and corrects imbalances in electrolyte levels, particularly addressing conditions like hyponatremia.</p>Formula:C27H29N3O2Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:427.54 g/molBenzamide, N-[4-[[5-(dimethylamino)-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl]carbonyl]phenyl]-2-methyl-
CAS:Formula:C27H29N3O2Purity:98%Color and Shape:SolidMolecular weight:427.5381





