CAS 137975-06-5: Mozavaptan
Description:Mozavaptan is a chemical compound classified as a vasopressin receptor antagonist, specifically targeting the V2 receptor subtype. It is primarily investigated for its potential therapeutic applications in treating conditions such as hyponatremia and heart failure. The compound exhibits a unique structure that allows it to effectively inhibit the action of vasopressin, a hormone that regulates water retention in the kidneys. Mozavaptan's mechanism of action involves blocking the reabsorption of water, leading to increased urine output and a subsequent rise in serum sodium levels. In terms of physical properties, it is typically presented as a white to off-white solid, and its solubility profile suggests it is soluble in organic solvents but may have limited solubility in water. Safety and efficacy studies are crucial for understanding its pharmacokinetics and potential side effects. Overall, Mozavaptan represents a significant advancement in the management of fluid balance disorders, although further research is necessary to fully elucidate its clinical benefits and risks.
Formula:C27H29N3O2
InChI:InChI=1S/C27H29N3O2/c1-19-9-4-5-10-22(19)26(31)28-21-16-14-20(15-17-21)27(32)30-18-8-13-24(29(2)3)23-11-6-7-12-25(23)30/h4-7,9-12,14-17,24H,8,13,18H2,1-3H3,(H,28,31)
InChI key:InChIKey=WRNXUQJJCIZICJ-UHFFFAOYSA-N
SMILES:O=C(NC1=CC=C(C=C1)C(=O)N2C=3C=CC=CC3C(N(C)C)CCC2)C=4C=CC=CC4C
- Synonyms:
- 1H-1-Benzazepine, benzamide deriv.
- 5-(Dimethylamino)-1-[4-(2-methylbenzamido)benzoyl]-2,3,4,5-tetrahydro-1H-benzazepine
- Benzamide, N-[4-[[5-(dimethylamino)-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl]carbonyl]phenyl]-2-methyl-
- N-(4-{[5-(dimethylamino)-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl]carbonyl}phenyl)-2-methylbenzamide
- Opc 31260
- Mozavaptan
![Benzamide, N-[4-[[5-(dimethylamino)-2,3,4,5-tetrahydro-1H-1-benzazepin-1-yl]carbonyl]phenyl]-2-met…](https://static.cymitquimica.com/products/IN/thumb/DA0017QW.jpg)
