CymitQuimica logo

CAS 137977-97-0

:

1-(4-Amino-2-methylbenzoyl)-7-chloro-1,2,3,4-tetrahydro-5H-1-benzazepin-5-one

Description:
1-(4-Amino-2-methylbenzoyl)-7-chloro-1,2,3,4-tetrahydro-5H-1-benzazepin-5-one, with CAS number 137977-97-0, is a chemical compound that belongs to the class of benzazepines, which are characterized by a fused bicyclic structure containing a benzene ring and a seven-membered nitrogen-containing ring. This compound features an amino group and a chloro substituent, which can influence its reactivity and biological activity. The presence of the benzoyl moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its tetrahydro structure indicates that it may exhibit specific stereochemical properties, which can affect its pharmacokinetics and pharmacodynamics. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, this substance may have applications in drug development, particularly in the context of targeting specific receptors or enzymes in biological systems. Further studies would be necessary to elucidate its full range of properties and potential therapeutic uses.
Formula:C18H17ClN2O2
InChI:InChI=1S/C18H17ClN2O2/c1-11-9-13(20)5-6-14(11)18(23)21-8-2-3-17(22)15-10-12(19)4-7-16(15)21/h4-7,9-10H,2-3,8,20H2,1H3
InChI key:FLJCJPKXJWRZJB-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1)N)C(=O)N2CCCC(=O)C3=C2C=CC(=C3)Cl
Found 8 products.