CAS 138-60-3: Chelidamic acid
Description:Chelidamic acid, with the CAS number 138-60-3, is an organic compound classified as a derivative of amino acids. It is characterized by its structure, which includes a carboxylic acid functional group and an amino group, making it a member of the amino acid family. This compound is typically found in a crystalline form and is known for its relatively low solubility in water, which can vary depending on the pH of the solution. Chelidamic acid exhibits properties that allow it to participate in various chemical reactions, including those typical of amino acids, such as peptide bond formation. It has applications in biochemical research and may serve as an intermediate in the synthesis of other organic compounds. Additionally, its biological significance is noted in certain metabolic pathways. Overall, chelidamic acid is an important compound in both organic chemistry and biochemistry, contributing to the understanding of amino acid behavior and interactions.
Formula:C7H5NO5
InChI:InChI=1S/C7H5NO5/c9-3-1-4(6(10)11)8-5(2-3)7(12)13/h1-2H,(H,8,9)(H,10,11)(H,12,13)
InChI key:InChIKey=XTLJJHGQACAZMS-UHFFFAOYSA-N
SMILES:O=C1C=C(NC(=C1)C(=O)O)C(=O)O
- Synonyms:
- 1,4-Dihydro-4-Oxo-2,6-Pyridinedicarboxylic Acid
- 1,4-Dihydro-4-oxopyridine-2,6-dicarboxylic acid
- 2,6-Pyridinedicarboxylic acid, 1,4-dihydro-4-oxo-
- 2,6-Pyridinedicarboxylic acid, 1,4-dihydro-4-oxo- (8CI)(9CI)
- 4-Hydroxypyridine-2,6-dicarboxylic acid
- 4-Oxo-1,4-Dihydropyridine-2,6-Dicarboxylate
- 4-Oxo-1,4-Dihydropyridine-2,6-Dicarboxylic Acid
- Chelidamic aicd
- NSC 3983
- Chelidamic acid
- See more synonyms
