CAS 138042-37-2

1-Bicyclo[3.1.0]hex-1-yl-2-propanone

Description:

1-Bicyclo[3.1.0]hex-1-yl-2-propanone, with the CAS number 138042-37-2, is an organic compound characterized by its bicyclic structure, which consists of a bicyclo[3.1.0]hexane framework. This compound features a ketone functional group, specifically at the 2-position of a propanone moiety, contributing to its reactivity and potential applications in organic synthesis. The bicyclic structure imparts unique steric and electronic properties, influencing its behavior in chemical reactions. Typically, compounds of this nature may exhibit moderate volatility and solubility in organic solvents, while their stability can vary depending on the substituents and conditions. The presence of the ketone group suggests potential for nucleophilic attack, making it a candidate for further functionalization. Additionally, the compound may have implications in fields such as medicinal chemistry or materials science, where bicyclic structures are often explored for their biological activity or as building blocks in complex organic molecules. However, specific physical and chemical properties would require empirical data for precise characterization.

Formula: C₉H₁₄O

InChI: InChI=1S/C9H14O/c1-7(10)5-9-4-2-3-8(9)6-9/h8H,2-6H2,1H3

InChI key: InChIKey=SQTCHBUCXXGLIN-UHFFFAOYSA-N

SMILES: C(C(C)=O)C12C(C1)CCC2

Synonyms:

• 1-[Bicyclo[3.1.0]hexan-1-yl]propan-2-one
• 2-Propanone, 1-bicyclo[3.1.0]hex-1-yl-
• 1-Bicyclo[3.1.0]hex-1-yl-2-propanone

2-Propanone, 1-bicyclo[3.1.0]hex-1-yl-

CAS: 138042-37-2

Formula: C₉H₁₄O

Molecular weight: 138.2069

Ref: IN-DA0017VQ