CAS 138046-43-2
:Urea,N-cycloheptyl-N-(9H-fluoren-2-ylmethyl)-N'-(2,4,6-trimethylphenyl)-
Description:
Urea, N-cycloheptyl-N-(9H-fluoren-2-ylmethyl)-N'-(2,4,6-trimethylphenyl)-, with the CAS number 138046-43-2, is a synthetic organic compound characterized by its urea functional group, which consists of a carbonyl group (C=O) bonded to two amine groups (NH2). This particular compound features a complex structure with a cycloheptyl group, a fluorenylmethyl moiety, and a trimethylphenyl substituent, contributing to its unique chemical properties. The presence of these bulky groups may influence its solubility, stability, and reactivity, making it of interest in various chemical applications, including potential roles in pharmaceuticals or materials science. The compound's molecular structure suggests it may exhibit specific interactions with biological targets or materials, which could be explored in research settings. Additionally, the presence of multiple functional groups may allow for further chemical modifications, enhancing its utility in synthetic chemistry. As with all chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C31H36N2O
InChI:InChI=1S/C31H36N2O/c1-21-16-22(2)30(23(3)17-21)32-31(34)33(27-11-6-4-5-7-12-27)20-24-14-15-29-26(18-24)19-25-10-8-9-13-28(25)29/h8-10,13-18,27H,4-7,11-12,19-20H2,1-3H3,(H,32,34)
InChI key:FMLJREWZCZHGGW-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C(=C1)C)NC(=O)N(CC2=CC3=C(C=C2)C4=CC=CC=C4C3)C5CCCCCC5)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
YM-750
CAS:Formula:C31H36N2OPurity:>93.0%(HPLC)(qNMR)Color and Shape:White to Light yellow powder to crystalMolecular weight:452.641-((9H-Fluoren-2-yl)methyl)-1-cycloheptyl-3-mesitylurea
CAS:Formula:C31H36N2OPurity:98%Color and Shape:SolidMolecular weight:452.6303Ref: IN-DA0017WJ
1gTo inquire250mgTo inquire1mg62.00€10mg117.00€5mg122.00€25mg195.00€50mg329.00€100mg626.00€YM-750
CAS:1-((9H-Fluoren-2-yl)methyl)-1-cycloheptyl-3-mesitylureaFormula:C31H36N2OPurity:99%Molecular weight:452.63YM-750
CAS:YM-750 is a potent inhibitor of acyl-CoA:cholesterol acyltransferase (ACAT), with an IC50 value of 0.18 μM.Formula:C31H36N2OPurity:99.96%Color and Shape:SolidMolecular weight:452.63Ref: TM-T23550
2mg34.00€5mg52.00€1mL*10mM (DMSO)55.00€10mg82.00€25mg148.00€50mg234.00€100mg335.00€200mg515.00€YM 750
CAS:YM 750 is an anti-atherogenic drug that inhibits the formation of atherogenic low density lipoproteins (LDL) by inhibiting cholesterol acyltransferase. It also has inhibitory effects on thp-1 cells, which are human monocytic leukemia cells. YM 750 reduces the expression of a number of proteins in these cells, including apoptotic proteins and proteins involved in cellular differentiation. YM 750 is being investigated as a potential therapy for metabolic disorders and may be useful in the treatment of diabetes mellitus type 2.Formula:C31H36N2OPurity:Min. 95%Molecular weight:452.63 g/mol





