CymitQuimica logo

CAS 138165-75-0

:

3-[(T-BUTOXYCARBONYL)AMINO]-5-METHYLHEXANOICACID

Description:
3-[(T-Butoxycarbonyl)amino]-5-methylhexanoic acid, identified by its CAS number 138165-75-0, is an amino acid derivative characterized by the presence of a t-butoxycarbonyl (Boc) protecting group on the amino functional group. This compound features a hexanoic acid backbone with a methyl group at the 5-position, contributing to its branched structure. The Boc group is commonly used in organic synthesis to protect amines during chemical reactions, allowing for selective modifications of other functional groups. The presence of both the carboxylic acid and amine functionalities makes this compound amphipathic, which can influence its solubility and reactivity in various solvents. Additionally, the branched structure may affect its steric properties and interactions in biological systems. This compound is often utilized in peptide synthesis and other applications in medicinal chemistry, where the protection of amino groups is crucial for the successful formation of peptide bonds. Overall, its unique structural features make it a valuable intermediate in organic synthesis and pharmaceutical development.
Formula:C12H23NO4
InChI:InChI=1/C12H23NO4/c1-8(2)6-9(7-10(14)15)13-11(16)17-12(3,4)5/h8-9H,6-7H2,1-5H3,(H,13,16)(H,14,15)
InChI key:XRVAMBSTOWHUMM-UHFFFAOYSA-N
SMILES:CC(C)CC(CC(=O)O)N=C(O)OC(C)(C)C
Synonyms:
  • 3-Boc-amino-5-methylhexanoic acid
  • 3-[(Tert-Butoxycarbonyl)Amino]-5-Methylhexanoic Acid
Found 3 products.