CAS 1381944-74-6
:5-Bromo-1-ethyl-6-fluoro-2-methyl-1H-benzimidazole
Description:
5-Bromo-1-ethyl-6-fluoro-2-methyl-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with bromine, fluorine, and ethyl and methyl groups. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of halogen substituents. The bromine and fluorine atoms can influence the compound's electronic properties, potentially enhancing its biological activity or reactivity in chemical reactions. Benzimidazole derivatives are often studied for their pharmacological properties, including antimicrobial and anticancer activities. The presence of the ethyl and methyl groups can affect the compound's lipophilicity and steric hindrance, which may play a role in its interaction with biological targets. Overall, 5-Bromo-1-ethyl-6-fluoro-2-methyl-1H-benzimidazole represents a class of compounds with diverse applications in medicinal chemistry and material science.
Formula:C10H10BrFN2
InChI:InChI=1S/C10H10BrFN2/c1-3-14-6(2)13-9-4-7(11)8(12)5-10(9)14/h4-5H,3H2,1-2H3
InChI key:InChIKey=VGGPNTMICVOHLJ-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(N=C1C)=CC(Br)=C(F)C2
Synonyms:- 1H-Benzimidazole, 5-bromo-1-ethyl-6-fluoro-2-methyl-
- 5-Bromo-1-ethyl-6-fluoro-2-methyl-1H-benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
