CAS 138199-51-6
:α-Amino-2H-tetrazole-5-acetic acid
Description:
α-Amino-2H-tetrazole-5-acetic acid, with the CAS number 138199-51-6, is a chemical compound characterized by its tetrazole ring structure, which is a five-membered ring containing four nitrogen atoms and one carbon atom. This compound features an amino group and an acetic acid moiety, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. It is typically a white to off-white solid that is soluble in water and polar organic solvents, making it useful in various chemical reactions. The presence of both the amino and carboxylic acid functional groups allows for diverse reactivity, including peptide bond formation and other coupling reactions. Additionally, α-amino tetrazoles are of interest in the field of pharmaceuticals due to their potential biological activities, including antimicrobial and antitumor properties. As with many nitrogen-containing compounds, it may exhibit unique properties such as stability under certain conditions and reactivity towards electrophiles and nucleophiles, making it a valuable compound in research and development.
Formula:C3H5N5O2
InChI:InChI=1S/C3H5N5O2/c4-1(3(9)10)2-5-7-8-6-2/h1H,4H2,(H,9,10)(H,5,6,7,8)
InChI key:InChIKey=UKBRUIZWQZHXFL-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N)C=1NN=NN1
Synonyms:- (Tetrazol-5-Yl)Glycine
- 1H-Tetrazole-5-acetic acid, α-amino-
- 2-Amino-2-(1H-1,2,3,4-tetrazol-5-yl)acetic acid
- 2-Amino-2-(2H-1,2,3,4-tetrazol-5-yl)acetic acid
- 2-Amino-2-(2H-tetrazol-5-yl)acetic acid
- 2H-Tetrazole-5-acetic acid, α-amino-
- Ly 285265
- amino(2H-tetrazol-5-yl)acetic acid
- α-Amino-2H-tetrazole-5-acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2H-Tetrazole-5-acetic acid, α-amino-
CAS:Formula:C3H5N5O2Purity:95%Color and Shape:SolidMolecular weight:143.1041(RS)-(Tetrazol-5-yl)glycine
CAS:(RS)-(Tetrazol-5-yl)glycine (LY 285265) is a selective NMDA receptor agonist with EC50 of 99 nM (GluN1/GluN2D) and 1.7 μM (GluN1/GluN2A).
Formula:C3H5N5O2Purity:95.00%Color and Shape:SolidMolecular weight:143.1(RS)-(Tetrazol-5-yl)glycine
CAS:Controlled ProductFormula:C3H5N5O2Color and Shape:NeatMolecular weight:143.104alpha-Amino-2H-tetrazole-5-acetic acid
CAS:Alpha-amino-2H-tetrazole-5-acetic acid (AAT) is a neurotoxin that inhibits glutamate receptors and causes neuronal cell death. It also decreases heart function in rats by inhibiting the cardiac sodium channel. AAT has been shown to be effective for inducing neuronal death in Xenopus oocytes, as well as decreasing the expression of certain receptor protein, such as NMDA and AMPA receptor subtypes. AAT is also known to cause apoptosis, which may be due to its inhibition of receptor function.Formula:C3H5N5O2Purity:Min. 95%Color and Shape:Light (Or Pale) Green To Green SolidMolecular weight:143.1 g/mol




