CymitQuimica logo

CAS 138377-34-1

:

2-Chloro-3-hydroxybenzotrifluoride

Description:
2-Chloro-3-hydroxybenzotrifluoride, with the CAS number 138377-34-1, is an organic compound characterized by the presence of a hydroxyl group (-OH), a chlorine atom, and three fluorine atoms attached to a benzene ring. This compound belongs to the class of substituted phenols and is notable for its potential applications in various chemical processes, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The presence of the hydroxyl group contributes to its polarity, enhancing its solubility in polar solvents, while the trifluoromethyl groups can impart unique electronic properties, influencing reactivity and stability. Additionally, the chlorine atom can affect the compound's biological activity and environmental persistence. Overall, 2-Chloro-3-hydroxybenzotrifluoride exhibits a combination of hydrophilic and lipophilic characteristics, making it a compound of interest in both industrial and research settings. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can pose environmental and health risks.
Formula:C7H4ClF3O
InChI:InChI=1/C7H4ClF3O/c8-6-4(7(9,10)11)2-1-3-5(6)12/h1-3,12H
InChI key:BGXZMBZFGAIBDH-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1)O)Cl)C(F)(F)F
Synonyms:
  • 2-Chloro-3-(trifluoromethyl)phenol
Found 3 products.