CymitQuimica logo

CAS 138500-86-4

:

4-(Cyanomethyl)benzeneboronic acid Pinacol ester

Description:
4-(Cyanomethyl)benzeneboronic acid pinacol ester is an organoboron compound characterized by the presence of a boronic acid moiety and a cyanomethyl group attached to a phenyl ring. This compound typically exhibits properties associated with boron-containing compounds, such as the ability to form complexes with various substrates, making it useful in organic synthesis and medicinal chemistry. The pinacol ester functionality enhances its stability and solubility, facilitating its use in various reactions, including Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. The presence of the cyanomethyl group can also impart unique reactivity, allowing for further functionalization. Additionally, this compound may exhibit moderate polarity due to the presence of both the boronic acid and the cyanomethyl group, influencing its solubility in different solvents. Overall, 4-(Cyanomethyl)benzeneboronic acid pinacol ester is a versatile intermediate in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C14H18BNO2
InChI:InChI=1/C14H18BNO2/c1-13(2)14(3,4)18-15(17-13)12-7-5-11(6-8-12)9-10-16/h5-8H,9H2,1-4H3
InChI key:URWMFRYGXSHPRV-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2ccc(cc2)CC#N)O1
Synonyms:
  • 4-(Cyanomethyl)phenylboronic acid pinacol cyclic ester
  • 2-[(4-Cyanomethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
  • 4-(Cyanomethyl)benzeneboronic acid pinacol cyclic ester
  • [4-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Phenyl]Acetonitrile
  • 4-(Cyanomethyl)phenylboronic acid pinacol ester
Found 4 products.