CAS 1385696-79-6

Piperidine, 2-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)-, hydrochloride (1:1)

Description:

Piperidine, 2-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic amine. The presence of the 3-cyclobutyl-1,2,4-oxadiazol-5-yl substituent introduces unique properties, including potential biological activity due to the oxadiazole moiety, which is often associated with pharmacological effects. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in medicinal chemistry. The compound may exhibit specific reactivity patterns due to the functional groups present, making it of interest for synthesis and research in drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Safety and handling precautions should be observed, as with all chemical substances, particularly those with unknown toxicity profiles.

Formula: C₁₁H₁₇N₃O·ClH

InChI: InChI=1S/C11H17N3O.ClH/c1-2-7-12-9(6-1)11-13-10(14-15-11)8-4-3-5-8;/h8-9,12H,1-7H2;1H

InChI key: InChIKey=DYCYZEXSPKJXSA-UHFFFAOYSA-N

SMILES: C=1(N=C(ON1)C2CCCCN2)C3CCC3.Cl

Synonyms:

• Piperidine, 2-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)-, hydrochloride (1:1)

2-(3-Cyclobutyl-1,2,4-oxadiazol-5-yl)piperidine hydrochloride

CAS: 1385696-79-6

Formula: C₁₁H₁₈ClN₃O

Molecular weight: 243.74

Ref: 10-F097289