CAS 13871-68-6
:Phenol, 4-amino-, 1-acetate
Description:
Phenol, 4-amino-, 1-acetate, also known as 4-aminoacetophenone, is an organic compound characterized by the presence of an amino group and an acetate functional group attached to a phenolic structure. This compound typically appears as a white to light yellow crystalline solid. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water due to its hydrophobic aromatic ring. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, including electrophilic aromatic substitution and acylation. The acetate group can undergo hydrolysis, releasing acetic acid and the corresponding amine. This compound is of interest in various fields, including pharmaceuticals and dye synthesis, due to its potential as an intermediate in the production of more complex molecules. Safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled, and appropriate personal protective equipment should be used.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c1-6(10)11-8-4-2-7(9)3-5-8/h2-5H,9H2,1H3
InChI key:InChIKey=QVJWBJWRAPJXNM-UHFFFAOYSA-N
SMILES:O(C(C)=O)C1=CC=C(N)C=C1
Synonyms:- (4-Aminophenyl)Acetate
- 2-(4-Aminophenyl)Acetic Acid
- 4-Acetoxyaniline
- 4-Aminophenyl acetate HCl
- 4-Aminophenyl acetic acid
- Acetic Acid 4-Aminophenyl Ester
- Akos Bbs-00006880
- H-4-Aph-Oh
- H-Aph(4)-Oh
- Phenol, 4-amino-, 1-acetate
- Phenol, 4-amino-, acetate (ester)
- Phenol, p-amino-, acetate
- Phenol, p-amino-, acetate (ester)
- Rarechem Al Bo 0220
- p-Acetoxyaniline
- p-Aminophenyl acetate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Phenol, 4-amino-, acetate (ester)
CAS:Formula:C8H9NO2Purity:97%Color and Shape:SolidMolecular weight:151.16264-Aminophenyl acetate HCl
CAS:4-Aminophenyl acetate HCl is a synthetic chemical that has been shown to have anticancer activity. It inhibits the growth of cancer cells in vitro and in vivo, with efficacy against a wide range of tumor types. 4-Aminophenyl acetate HCl is also an inhibitor of the shikimate pathway, which is essential for the synthesis of aromatic amino acids such as phenylalanine and tyrosine, and pro-inflammatory cytokines such as IL-6 and TNFα. 4-Aminophenyl acetate HCl has pharmacokinetic properties that are dose dependent; it exhibits low bioavailability and high clearance rates. This drug also possesses pharmacological treatment properties that inhibit the production of pro-inflammatory cytokines.Formula:C8H10ClNO2Purity:Min. 95%Molecular weight:187.62 g/mol




