CAS 138772-01-7

Formula: C22H32O11

InChI: InChI=1S/C22H32O11/c1-4-5-11-6-7-12(13(8-11)29-3)32-22-20(28)18(26)16(24)14(33-22)9-30-21-19(27)17(25)15(23)10(2)31-21/h4,6-8,10,14-28H,1,5,9H2,2-3H3/t10-,14+,15-,16+,17+,18-,19+,20+,21+,22+/m0/s1

InChI key: KNUPPNGCEAQRSV-XCPHWCDESA-N

SMILES: C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(C=C(C=C3)CC=C)OC)O)O)O)O)O)O

Eugenol Rutinoside

CAS: 138772-01-7

Eugenol Rutinoside

Formula: C₂₂H₃₂O₁₁

Purity: ≥95%

Molecular weight: 472.48

Ref: 54-OR1132774

Eugenol rutinoside

CAS: 138772-01-7

Formula: C₂₂H₃₂O₁₁

Purity: 95%~99%

Molecular weight: 472.487

Ref: BP-SBP02244

Eugenol rutinoside

CAS: 138772-01-7

Eugenol rutinoside is a natural product found in dendropanax dentiger.

Formula: C₂₂H₃₂O₁₁

Purity: 98%

Color and Shape: Solid

Molecular weight: 472.4829

Ref: TM-TN4033

Eugenol rutinoside

CAS: 138772-01-7

Eugenol rutinoside is a bioactive compound, which is derived from certain plant species known for their medicinal properties. It is formed by the glycosylation of eugenol, a phenolic compound, with a rutinoside sugar moiety. This derivation typically occurs in plants such as cloves and other members of the Myrtaceae family.

Formula: C₂₂H₃₂O₁₁

Purity: Min. 95%

Molecular weight: 472.48 g/mol

Ref: 3D-OE44165