CymitQuimica logo

CAS 13887-50-8

:

Propanamide, 2-bromo-N,N,2-trimethyl-

Description:
Propanamide, 2-bromo-N,N,2-trimethyl- is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a bromine atom at the second carbon position and three methyl groups attached to the nitrogen atom contributes to its unique structural and chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in organic solvents but may have limited solubility in water due to its hydrophobic methyl groups. The bromine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of multiple methyl groups can enhance steric hindrance, affecting the compound's reactivity and interaction with other molecules. As with many brominated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns. Proper safety measures should be observed when working with or disposing of this chemical.
Formula:C6H12BrNO
InChI:InChI=1S/C6H12BrNO/c1-6(2,7)5(9)8(3)4/h1-4H3
InChI key:CNUHUXQSZVLAGL-UHFFFAOYSA-N
SMILES:CC(C)(C(=O)N(C)C)Br
Found 3 products.