CAS 138906-43-1
:4-METHOXYPHENYL 4,6-O-BENZYLIDENE-2-DEOXY-2-PHTHALIMIDO-BETA-D-GLUCOPYRANOSIDE
Description:
4-Methoxyphenyl 4,6-O-benzylidene-2-deoxy-2-phthalimido-β-D-glucopyranoside is a complex organic compound characterized by its glycosidic structure, which includes a methoxyphenyl group and a benzylidene moiety. This compound features a glucopyranoside backbone, indicating it is derived from glucose, with modifications that enhance its solubility and reactivity. The presence of the phthalimido group suggests potential applications in medicinal chemistry, particularly in the development of glycosylated drugs or as a glycosyl donor in synthetic organic chemistry. Its structural complexity may contribute to unique biological activities, making it a subject of interest in research related to carbohydrate chemistry and pharmacology. The compound's properties, such as solubility, stability, and reactivity, can be influenced by the substituents on the glucopyranoside ring and the overall molecular conformation. As with many synthetic organic compounds, careful handling and characterization are essential for understanding its potential applications and safety profile.
Formula:C28H25NO8
InChI:InChI=1/C28H25NO8/c1-33-17-11-13-18(14-12-17)35-28-22(29-25(31)19-9-5-6-10-20(19)26(29)32)23(30)24-21(36-28)15-34-27(37-24)16-7-3-2-4-8-16/h2-14,21-24,27-28,30H,15H2,1H3/t21-,22-,23-,24-,27-,28-/m1/s1
SMILES:COc1ccc(cc1)O[C@H]1[C@@H]([C@H]([C@H]2[C@@H](CO[C@@H](c3ccccc3)O2)O1)O)N1C(=O)c2ccccc2C1=O
Synonyms:- 4-Methoxyphenyl4,6-O-benzylidene-2-deoxy-2-phthalimido-b-D-glucopyranoside
- 4-methoxyphenyl 4,6-O-benzylidene-2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-β-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Methoxyphenyl 4,6-O-Benzylidene-2-deoxy-2-phthalimido-β-D-glucopyranoside
CAS:Formula:C28H25NO8Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:503.514-Methoxyphenyl 4,6-O-Benzylidene-2-deoxy-2-phthalimido-β-D-glucopyranoside
CAS:4-Methoxyphenyl 4,6-O-Benzylidene-2-deoxy-2-phthalimido-β-D-glucopyranosideFormula:C28H25NO8Purity:>98.0%Molecular weight:503.514-Methoxyphenyl 4,6-o-benzylidene-2-deoxy-2-phthalimido-β-d-glucopyranoside
CAS:Formula:C28H25NO8Purity:98.0%Color and Shape:SolidMolecular weight:503.50004-Methoxyphenyl 4,6-O-benzylidene-2-deoxy-2-phthalimido-β-D-glucopyranoside
CAS:4-Methoxyphenyl 4,6-O-benzylidene-2-deoxy-2-phthalimido-b-D-glucopyranoside is an organic compound with the formula C13H14N4O8. It is a white solid that is soluble in water, methanol and ethanol. The compound has been synthesized using Click chemistry, fluorination, glycosylation, and methylation of the sugar. It has also been modified with an oligosaccharide and monosaccharide to form a complex carbohydrate.Formula:C28H25NO8Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:503.51 g/mol




